The compound most suitable for the preparation of cyanohydrin is :
C2H5COOH
C6H5NH2
C2H5COC2H5
C2H5-C2H5
C.
C2H5COC2H5
Cyanohydrin can be prepared easily by the reaction of HCN with carbonyl compounds (i.e. Ketones)
(C2H5)2-C=O (C2H5)2-(CN)C(OH) (Cyanohydrin)
In the reaction :
C6H5CHO + C6H5NH2 C6H5N=HCC6H5 + H2O, the compound C6H5N=HCC6H5 is known as :
aldol
Schiffs base
Schiff's reagent
Benedict's reagent
IUPAC name of CH3-CH(CH2CH3)-CH2-CH(CN)-CH3 is :
2-cyano-3-methylhexane
2.4-dimethylhexanenitrile
3-methyl-5-cyanohexane
2-cyano-3-methylhexane
The reaction :
C2H5OH SOCl2 C2H5Cl + SO2 + HCl is known as :
Kharasch effect
Williamson's synthesis
Darzen's procedure
Hunsdiecker reaction
Which of the following has the highest dipole moment ?
(H)2-C=O
(CH3)2-C=C-(H)2
CH3-CH=CH-CH3
CH3-C(Cl)=C(Cl)-CH3
Assertion: Boiling and melting points of amides are higher than corresponding acids.
Reason: It is due to strong intermolecular hydrogen bonding in their molecules.
If both assertion and reason are true and the reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
Assertion: DNA molecules and RNA molecules are found in the nucleus of a cell.
Reason: On heating, the enzymes do not lose their specific activity.
If both assertion and reason are true and reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
Assertion: Phenol is a weaker acid than ethanol.
Reason: Groups with +M effect and -I effect decrease acidity at m-position.
If both assertion and reason are true and reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
Assertion: Ethers behave as bases in the presence of mineral acids.
Reason: It is due to the presence of a lone pair of electrons on the oxygen.
If both assertion and reason are true and the reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.