The compound most suitable for the preparation of cyanohydrin is :
C2H5COOH
C6H5NH2
C2H5COC2H5
C2H5-C2H5
In the reaction :
C6H5CHO + C6H5NH2 C6H5N=HCC6H5 + H2O, the compound C6H5N=HCC6H5 is known as :
aldol
Schiffs base
Schiff's reagent
Benedict's reagent
IUPAC name of CH3-CH(CH2CH3)-CH2-CH(CN)-CH3 is :
2-cyano-3-methylhexane
2.4-dimethylhexanenitrile
3-methyl-5-cyanohexane
2-cyano-3-methylhexane
The reaction :
C2H5OH SOCl2 C2H5Cl + SO2 + HCl is known as :
Kharasch effect
Williamson's synthesis
Darzen's procedure
Hunsdiecker reaction
Which of the following has the highest dipole moment ?
(H)2-C=O
(CH3)2-C=C-(H)2
CH3-CH=CH-CH3
CH3-C(Cl)=C(Cl)-CH3
Assertion: Boiling and melting points of amides are higher than corresponding acids.
Reason: It is due to strong intermolecular hydrogen bonding in their molecules.
If both assertion and reason are true and the reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
Assertion: DNA molecules and RNA molecules are found in the nucleus of a cell.
Reason: On heating, the enzymes do not lose their specific activity.
If both assertion and reason are true and reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
D.
If both the assertion and reason are false.
In the cell, DNA molecules (i.e. Deoxyribose Nucleic acid) are present predominantly in the nucleus, some DNA is also present in the mitochondria in Eukaryotes.
RNA molecules (i.e. Ribose nucleic acid) are present in the cytoplasm of the eukaryotes and in the nucleus in some prokaryotes and viruses.
Assertion: Phenol is a weaker acid than ethanol.
Reason: Groups with +M effect and -I effect decrease acidity at m-position.
If both assertion and reason are true and reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.
Assertion: Ethers behave as bases in the presence of mineral acids.
Reason: It is due to the presence of a lone pair of electrons on the oxygen.
If both assertion and reason are true and the reason is a correct explanation of the assertion.
If both the assertion and reason are true but the reason is not a correct explanation of the assertion.
If the assertion is true but the reason is false.
If both the assertion and reason are false.